About 4-(2,3-dimethylimidazol-3-ium-1-yl)butane-1-sulfonohydrazide;trifluoromethanesulfonate
4-(2,3-dimethylimidazol-3-ium-1-yl)butane-1-sulfonohydrazide;trifluoromethanesulfonate (PubChem CID 71619311) has the molecular formula C10H19F3N4O5S2
and a molecular weight of 396.41 g/mol. Its IUPAC name is 4-(2,3-dimethylimidazol-3-ium-1-yl)butane-1-sulfonohydrazide;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 4-(2,3-dimethylimidazol-3-ium-1-yl)butane-1-sulfonohydrazide;trifluoromethanesulfonate |
| PubChem CID | 71619311 |
| Molecular Formula | C10H19F3N4O5S2 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 4-(2,3-dimethylimidazol-3-ium-1-yl)butane-1-sulfonohydrazide;trifluoromethanesulfonate |
| SMILES | Cc1n(CCCCS(=O)(=O)NN)cc[n+]1C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C9H19N4O2S.CHF3O3S/c1-9-12(2)6-7-13(9)5-3-4-8-16(14,15)11-10;2-1(3,4)8(5,6)7/h6-7,11H,3-5,8,10H2,1-2H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | PEAAQBJPVJINON-UHFFFAOYSA-M |
| XLogP | -0.75 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,3-dimethylimidazol-3-ium-1-yl)butane-1-sulfonohydrazide;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-dimethylimidazol-3-ium-1-yl)butane-1-sulfonohydrazide;trifluoromethanesulfonate?
The IUPAC name of 4-(2,3-dimethylimidazol-3-ium-1-yl)butane-1-sulfonohydrazide;trifluoromethanesulfonate (CID 71619311) is 4-(2,3-dimethylimidazol-3-ium-1-yl)butane-1-sulfonohydrazide;trifluoromethanesulfonate.
What is the SMILES notation for 4-(2,3-dimethylimidazol-3-ium-1-yl)butane-1-sulfonohydrazide;trifluoromethanesulfonate?
The canonical SMILES for 4-(2,3-dimethylimidazol-3-ium-1-yl)butane-1-sulfonohydrazide;trifluoromethanesulfonate is Cc1n(CCCCS(=O)(=O)NN)cc[n+]1C.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of 4-(2,3-dimethylimidazol-3-ium-1-yl)butane-1-sulfonohydrazide;trifluoromethanesulfonate?
The InChIKey is PEAAQBJPVJINON-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H19N4O2S.CHF3O3S/c1-9-12(2)6-7-13(9)5-3-4-8-16(14,15)11-10;2-1(3,4)8(5,6)7/h6-7,11H,3-5,8,10H2,1-2H3;(H,5,6,7)/q+1;/p-1.
What are the key properties of 4-(2,3-dimethylimidazol-3-ium-1-yl)butane-1-sulfonohydrazide;trifluoromethanesulfonate?
4-(2,3-dimethylimidazol-3-ium-1-yl)butane-1-sulfonohydrazide;trifluoromethanesulfonate has a molecular weight of 396.41 g/mol, XLogP of -0.75, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dimethylimidazol-3-ium-1-yl)butane-1-sulfonohydrazide;trifluoromethanesulfonate is sourced from PubChem (CID 71619311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).