C24H21F3O2 — CID 71619391
(1S,7R)-5-(4-methoxyphenyl)-4-[4-(trifluoromethyl)phenyl]tricyclo[5.2.1.02,6]dec-4-en-3-one (PubChem CID 71619391) has the molecular formula C24H21F3O2 and a molecular weight of 398.42 g/mol. Its IUPAC name is (1S,7R)-5-(4-methoxyphenyl)-4-[4-(trifluoromethyl)phenyl]tricyclo[5.2.1.02,6]dec-4-en-3-one.
| Compound Name | (1S,7R)-5-(4-methoxyphenyl)-4-[4-(trifluoromethyl)phenyl]tricyclo[5.2.1.02,6]dec-4-en-3-one |
|---|---|
| PubChem CID | 71619391 |
| Molecular Formula | C24H21F3O2 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (1S,7R)-5-(4-methoxyphenyl)-4-[4-(trifluoromethyl)phenyl]tricyclo[5.2.1.02,6]dec-4-en-3-one |
| SMILES | COc1ccc(C2=C(c3ccc(C(F)(F)F)cc3)C(=O)C3C2[C@@H]2CC[C@H]3C2)cc1 |
| InChI | InChI=1S/C24H21F3O2/c1-29-18-10-6-13(7-11-18)19-20-15-2-3-16(12-15)22(20)23(28)21(19)14-4-8-17(9-5-14)24(25,26)27/h4-11,15-16,20,22H,2-3,12H2,1H3/t15-,16+,20?,22?/m1/s1 |
| InChIKey | LHFNWNZEUMMAQU-NSHQJVHBSA-N |
| XLogP | 5.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|