C20H26O4 — CID 71619524
1-[(1S,4R,13S)-9-hydroxy-1,5,5-trimethyl-6,15-dioxatetracyclo[9.3.1.04,13.07,12]pentadeca-7(12),8,10-trien-10-yl]-2-methylpropan-1-one (PubChem CID 71619524) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is 1-[(1S,4R,13S)-9-hydroxy-1,5,5-trimethyl-6,15-dioxatetracyclo[9.3.1.04,13.07,12]pentadeca-7(12),8,10-trien-10-yl]-2-methylpropan-1-one.
| Compound Name | 1-[(1S,4R,13S)-9-hydroxy-1,5,5-trimethyl-6,15-dioxatetracyclo[9.3.1.04,13.07,12]pentadeca-7(12),8,10-trien-10-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 71619524 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 1-[(1S,4R,13S)-9-hydroxy-1,5,5-trimethyl-6,15-dioxatetracyclo[9.3.1.04,13.07,12]pentadeca-7(12),8,10-trien-10-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)c1c(O)cc2c3c1O[C@@]1(C)CC[C@H]([C@@H]3C1)C(C)(C)O2 |
| InChI | InChI=1S/C20H26O4/c1-10(2)17(22)16-13(21)8-14-15-11-9-20(5,24-18(15)16)7-6-12(11)19(3,4)23-14/h8,10-12,21H,6-7,9H2,1-5H3/t11-,12+,20-/m0/s1 |
| InChIKey | COMRWAQJXJEENM-ZBUHCNDUSA-N |
| XLogP | 4.44 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |