C19H25F3O5S — CID 71619641
[2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,6-dimethoxyphenyl] trifluoromethanesulfonate (PubChem CID 71619641) has the molecular formula C19H25F3O5S and a molecular weight of 422.47 g/mol. Its IUPAC name is [2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,6-dimethoxyphenyl] trifluoromethanesulfonate.
| Compound Name | [2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,6-dimethoxyphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 71619641 |
| Molecular Formula | C19H25F3O5S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | [2-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,6-dimethoxyphenyl] trifluoromethanesulfonate |
| SMILES | COc1ccc(OC)c(OS(=O)(=O)C(F)(F)F)c1C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C19H25F3O5S/c1-13(2)7-6-8-14(3)9-10-15-16(25-4)11-12-17(26-5)18(15)27-28(23,24)19(20,21)22/h7,9,11-12H,6,8,10H2,1-5H3/b14-9+ |
| InChIKey | VICGLGGTBJJZLO-NTEUORMPSA-N |
| XLogP | 5.17 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|