C37H41N3O10 — CID 71619685
tetramethyl (9S,9aS)-3-cyano-2-(cyclohexylamino)-5'-cyclohexylimino-7-methylspiro[cyclopenta[b]chromene-9,2'-furan]-1,3',4',9a-tetracarboxylate (PubChem CID 71619685) has the molecular formula C37H41N3O10 and a molecular weight of 687.75 g/mol. Its IUPAC name is tetramethyl (9S,9aS)-3-cyano-2-(cyclohexylamino)-5'-cyclohexylimino-7-methylspiro[cyclopenta[b]chromene-9,2'-furan]-1,3',4',9a-tetracarboxylate.
| Compound Name | tetramethyl (9S,9aS)-3-cyano-2-(cyclohexylamino)-5'-cyclohexylimino-7-methylspiro[cyclopenta[b]chromene-9,2'-furan]-1,3',4',9a-tetracarboxylate |
|---|---|
| PubChem CID | 71619685 |
| Molecular Formula | C37H41N3O10 |
| Molecular Weight | 687.75 g/mol |
| Exact Mass | 687.28 |
| IUPAC Name | tetramethyl (9S,9aS)-3-cyano-2-(cyclohexylamino)-5'-cyclohexylimino-7-methylspiro[cyclopenta[b]chromene-9,2'-furan]-1,3',4',9a-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@]2(O/C1=N/C1CCCCC1)c1cc(C)ccc1OC1=C(C#N)C(NC3CCCCC3)=C(C(=O)OC)[C@]12C(=O)OC |
| InChI | InChI=1S/C37H41N3O10/c1-20-16-17-25-24(18-20)37(27(33(42)46-3)26(32(41)45-2)31(50-37)40-22-14-10-7-11-15-22)36(35(44)48-5)28(34(43)47-4)29(23(19-38)30(36)49-25)39-21-12-8-6-9-13-21/h16-18,21-22,39H,6-15H2,1-5H3/b40-31+/t36-,37+/m1/s1 |
| InChIKey | RUOVKIPPKRKKGH-XDIWVAJVSA-N |
| XLogP | 4.29 |
| TPSA | 171.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.75 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|