About 4-amino-3-(pyridin-2-ylmethylsulfanyl)-1,2,4-triazin-5-one
4-amino-3-(pyridin-2-ylmethylsulfanyl)-1,2,4-triazin-5-one (PubChem CID 7161977) has the molecular formula C9H9N5OS
and a molecular weight of 235.27 g/mol. Its IUPAC name is 4-amino-3-(pyridin-2-ylmethylsulfanyl)-1,2,4-triazin-5-one.
Molecular Properties
| Compound Name | 4-amino-3-(pyridin-2-ylmethylsulfanyl)-1,2,4-triazin-5-one |
| PubChem CID | 7161977 |
| Molecular Formula | C9H9N5OS |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 4-amino-3-(pyridin-2-ylmethylsulfanyl)-1,2,4-triazin-5-one |
| SMILES | Nn1c(SCc2ccccn2)nncc1=O |
| InChI | InChI=1S/C9H9N5OS/c10-14-8(15)5-12-13-9(14)16-6-7-3-1-2-4-11-7/h1-5H,6,10H2 |
| InChIKey | HTRIVOLIXKXNKP-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-amino-3-(pyridin-2-ylmethylsulfanyl)-1,2,4-triazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-(pyridin-2-ylmethylsulfanyl)-1,2,4-triazin-5-one?
The IUPAC name of 4-amino-3-(pyridin-2-ylmethylsulfanyl)-1,2,4-triazin-5-one (CID 7161977) is 4-amino-3-(pyridin-2-ylmethylsulfanyl)-1,2,4-triazin-5-one.
What is the SMILES notation for 4-amino-3-(pyridin-2-ylmethylsulfanyl)-1,2,4-triazin-5-one?
The canonical SMILES for 4-amino-3-(pyridin-2-ylmethylsulfanyl)-1,2,4-triazin-5-one is Nn1c(SCc2ccccn2)nncc1=O.
What is the InChIKey of 4-amino-3-(pyridin-2-ylmethylsulfanyl)-1,2,4-triazin-5-one?
The InChIKey is HTRIVOLIXKXNKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N5OS/c10-14-8(15)5-12-13-9(14)16-6-7-3-1-2-4-11-7/h1-5H,6,10H2.
What are the key properties of 4-amino-3-(pyridin-2-ylmethylsulfanyl)-1,2,4-triazin-5-one?
4-amino-3-(pyridin-2-ylmethylsulfanyl)-1,2,4-triazin-5-one has a molecular weight of 235.27 g/mol, XLogP of 0.04, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-(pyridin-2-ylmethylsulfanyl)-1,2,4-triazin-5-one is sourced from PubChem (CID 7161977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).