C28H24BrN3O2 — CID 71620256
8-benzoyl-7-(4-bromophenyl)-5-methyl-N-phenyl-1,2,3,7-tetrahydroimidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 71620256) has the molecular formula C28H24BrN3O2 and a molecular weight of 514.42 g/mol. Its IUPAC name is 8-benzoyl-7-(4-bromophenyl)-5-methyl-N-phenyl-1,2,3,7-tetrahydroimidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | 8-benzoyl-7-(4-bromophenyl)-5-methyl-N-phenyl-1,2,3,7-tetrahydroimidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 71620256 |
| Molecular Formula | C28H24BrN3O2 |
| Molecular Weight | 514.42 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | 8-benzoyl-7-(4-bromophenyl)-5-methyl-N-phenyl-1,2,3,7-tetrahydroimidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2)C(c2ccc(Br)cc2)C(C(=O)c2ccccc2)=C2NCCN12 |
| InChI | InChI=1S/C28H24BrN3O2/c1-18-23(28(34)31-22-10-6-3-7-11-22)24(19-12-14-21(29)15-13-19)25(27-30-16-17-32(18)27)26(33)20-8-4-2-5-9-20/h2-15,24,30H,16-17H2,1H3,(H,31,34) |
| InChIKey | ZDHGRMANBULQMX-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.42 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dhp_keto_A(9)', 'substructure': 'N/A'} |
|---|