About CID 71620322
CID 71620322 (PubChem CID 71620322) has the molecular formula C41H51Cl2N3Ru
and a molecular weight of 757.86 g/mol.
Molecular Properties
| Compound Name | CID 71620322 |
| PubChem CID | 71620322 |
| Molecular Formula | C41H51Cl2N3Ru |
| Molecular Weight | 757.86 g/mol |
| Exact Mass | 757.25 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1N1[C]N(c2c(C(C)C)cccc2C(C)C)CC1.CN(c1ccccc1)c1ccccc1C=[Ru](Cl)Cl |
| InChI | InChI=1S/C27H38N2.C14H13N.2ClH.Ru/c1-18(2)22-11-9-12-23(19(3)4)26(22)28-15-16-29(17-28)27-24(20(5)6)13-10-14-25(27)21(7)8;1-12-8-6-7-11-14(12)15(2)13-9-4-3-5-10-13;;;/h9-14,18-21H,15-16H2,1-8H3;1,3-11H,2H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | UNDQNGNTPYLPND-UHFFFAOYSA-L |
| XLogP | 12.03 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 757.86 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 71620322 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71620322?
The IUPAC name of CID 71620322 (CID 71620322) is not available.
What is the SMILES notation for CID 71620322?
The canonical SMILES for CID 71620322 is CC(C)c1cccc(C(C)C)c1N1[C]N(c2c(C(C)C)cccc2C(C)C)CC1.CN(c1ccccc1)c1ccccc1C=[Ru](Cl)Cl.
What is the InChIKey of CID 71620322?
The InChIKey is UNDQNGNTPYLPND-UHFFFAOYSA-L. The full InChI is InChI=1S/C27H38N2.C14H13N.2ClH.Ru/c1-18(2)22-11-9-12-23(19(3)4)26(22)28-15-16-29(17-28)27-24(20(5)6)13-10-14-25(27)21(7)8;1-12-8-6-7-11-14(12)15(2)13-9-4-3-5-10-13;;;/h9-14,18-21H,15-16H2,1-8H3;1,3-11H,2H3;2*1H;/q;;;;+2/p-2.
What are the key properties of CID 71620322?
CID 71620322 has a molecular weight of 757.86 g/mol, XLogP of 12.03, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71620322 is sourced from PubChem (CID 71620322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).