C41H51Cl2N3Ru — CID 71620322
CID 71620322 (PubChem CID 71620322) has the molecular formula C41H51Cl2N3Ru and a molecular weight of 757.86 g/mol.
| Compound Name | CID 71620322 |
|---|---|
| PubChem CID | 71620322 |
| Molecular Formula | C41H51Cl2N3Ru |
| Molecular Weight | 757.86 g/mol |
| Exact Mass | 757.25 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1N1[C]N(c2c(C(C)C)cccc2C(C)C)CC1.CN(c1ccccc1)c1ccccc1C=[Ru](Cl)Cl |
| InChI | InChI=1S/C27H38N2.C14H13N.2ClH.Ru/c1-18(2)22-11-9-12-23(19(3)4)26(22)28-15-16-29(17-28)27-24(20(5)6)13-10-14-25(27)21(7)8;1-12-8-6-7-11-14(12)15(2)13-9-4-3-5-10-13;;;/h9-14,18-21H,15-16H2,1-8H3;1,3-11H,2H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | UNDQNGNTPYLPND-UHFFFAOYSA-L |
| XLogP | 12.03 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.86 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |