C21H28O7 — CID 71620363
triethyl 1-[(4-oxocyclohex-2-en-1-yl)methyl]pent-4-yne-1,1,5-tricarboxylate (PubChem CID 71620363) has the molecular formula C21H28O7 and a molecular weight of 392.45 g/mol. Its IUPAC name is triethyl 1-[(4-oxocyclohex-2-en-1-yl)methyl]pent-4-yne-1,1,5-tricarboxylate.
| Compound Name | triethyl 1-[(4-oxocyclohex-2-en-1-yl)methyl]pent-4-yne-1,1,5-tricarboxylate |
|---|---|
| PubChem CID | 71620363 |
| Molecular Formula | C21H28O7 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | triethyl 1-[(4-oxocyclohex-2-en-1-yl)methyl]pent-4-yne-1,1,5-tricarboxylate |
| SMILES | CCOC(=O)C#CCCC(CC1C=CC(=O)CC1)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C21H28O7/c1-4-26-18(23)9-7-8-14-21(19(24)27-5-2,20(25)28-6-3)15-16-10-12-17(22)13-11-16/h10,12,16H,4-6,8,11,13-15H2,1-3H3 |
| InChIKey | LXYQQLBLVABYQE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|