About 3-pyrimidin-5-ylaniline
3-pyrimidin-5-ylaniline (PubChem CID 7162049) has the molecular formula C10H9N3
and a molecular weight of 171.20 g/mol. Its IUPAC name is 3-pyrimidin-5-ylaniline.
Molecular Properties
| Compound Name | 3-pyrimidin-5-ylaniline |
| PubChem CID | 7162049 |
| Molecular Formula | C10H9N3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 3-pyrimidin-5-ylaniline |
| SMILES | Nc1cccc(-c2cncnc2)c1 |
| InChI | InChI=1S/C10H9N3/c11-10-3-1-2-8(4-10)9-5-12-7-13-6-9/h1-7H,11H2 |
| InChIKey | DZEIKJMNXHOFHL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-pyrimidin-5-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrimidin-5-ylaniline?
The IUPAC name of 3-pyrimidin-5-ylaniline (CID 7162049) is 3-pyrimidin-5-ylaniline.
What is the SMILES notation for 3-pyrimidin-5-ylaniline?
The canonical SMILES for 3-pyrimidin-5-ylaniline is Nc1cccc(-c2cncnc2)c1.
What is the InChIKey of 3-pyrimidin-5-ylaniline?
The InChIKey is DZEIKJMNXHOFHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3/c11-10-3-1-2-8(4-10)9-5-12-7-13-6-9/h1-7H,11H2.
What are the key properties of 3-pyrimidin-5-ylaniline?
3-pyrimidin-5-ylaniline has a molecular weight of 171.20 g/mol, XLogP of 1.73, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrimidin-5-ylaniline is sourced from PubChem (CID 7162049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).