C11H15NO5 — CID 71620516
(2R,3S,4R,5R)-2-anilinooxyoxane-3,4,5-triol (PubChem CID 71620516) has the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-anilinooxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R)-2-anilinooxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 71620516 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | (2R,3S,4R,5R)-2-anilinooxyoxane-3,4,5-triol |
| SMILES | O[C@@H]1[C@@H](ONc2ccccc2)OC[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H15NO5/c13-8-6-16-11(10(15)9(8)14)17-12-7-4-2-1-3-5-7/h1-5,8-15H,6H2/t8-,9-,10+,11-/m1/s1 |
| InChIKey | UOEYCZRCGRRVDF-CHWFTXMASA-N |
| XLogP | -0.53 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|