C22H23FN4O — CID 71620818
3-(dimethylamino)-1-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-3-methylindol-2-one (PubChem CID 71620818) has the molecular formula C22H23FN4O and a molecular weight of 378.45 g/mol. Its IUPAC name is 3-(dimethylamino)-1-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-3-methylindol-2-one.
| Compound Name | 3-(dimethylamino)-1-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-3-methylindol-2-one |
|---|---|
| PubChem CID | 71620818 |
| Molecular Formula | C22H23FN4O |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 3-(dimethylamino)-1-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]-3-methylindol-2-one |
| SMILES | CN(C)C1(C)C(=O)N(Cc2ccc(-c3cnn(C)c3)cc2F)c2ccccc21 |
| InChI | InChI=1S/C22H23FN4O/c1-22(25(2)3)18-7-5-6-8-20(18)27(21(22)28)14-16-10-9-15(11-19(16)23)17-12-24-26(4)13-17/h5-13H,14H2,1-4H3 |
| InChIKey | JZUIZVDFFRUFGS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |