C26H30N4O4S — CID 71620940
2-acetamido-N-[(1S)-1-[4-[1-(4-ethoxyphenyl)azetidin-3-yl]oxyphenyl]ethyl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 71620940) has the molecular formula C26H30N4O4S and a molecular weight of 494.62 g/mol. Its IUPAC name is 2-acetamido-N-[(1S)-1-[4-[1-(4-ethoxyphenyl)azetidin-3-yl]oxyphenyl]ethyl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-acetamido-N-[(1S)-1-[4-[1-(4-ethoxyphenyl)azetidin-3-yl]oxyphenyl]ethyl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 71620940 |
| Molecular Formula | C26H30N4O4S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 2-acetamido-N-[(1S)-1-[4-[1-(4-ethoxyphenyl)azetidin-3-yl]oxyphenyl]ethyl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | CCOc1ccc(N2CC(Oc3ccc([C@H](C)NC(=O)c4sc(NC(C)=O)nc4C)cc3)C2)cc1 |
| InChI | InChI=1S/C26H30N4O4S/c1-5-33-21-12-8-20(9-13-21)30-14-23(15-30)34-22-10-6-19(7-11-22)16(2)27-25(32)24-17(3)28-26(35-24)29-18(4)31/h6-13,16,23H,5,14-15H2,1-4H3,(H,27,32)(H,28,29,31)/t16-/m0/s1 |
| InChIKey | QWTKWBKJVGEQNA-INIZCTEOSA-N |
| XLogP | 4.57 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|