About 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-piperidin-4-yltriazol-4-yl)pyridin-2-amine
3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-piperidin-4-yltriazol-4-yl)pyridin-2-amine (PubChem CID 71621328) has the molecular formula C20H21Cl2FN6O
and a molecular weight of 451.33 g/mol. Its IUPAC name is 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-piperidin-4-yltriazol-4-yl)pyridin-2-amine.
Molecular Properties
| Compound Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-piperidin-4-yltriazol-4-yl)pyridin-2-amine |
| PubChem CID | 71621328 |
| Molecular Formula | C20H21Cl2FN6O |
| Molecular Weight | 451.33 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-piperidin-4-yltriazol-4-yl)pyridin-2-amine |
| SMILES | CC(Oc1cc(-c2cn(C3CCNCC3)nn2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C20H21Cl2FN6O/c1-11(18-14(21)2-3-15(23)19(18)22)30-17-8-12(9-26-20(17)24)16-10-29(28-27-16)13-4-6-25-7-5-13/h2-3,8-11,13,25H,4-7H2,1H3,(H2,24,26) |
| InChIKey | NMJLXRYSZZFMOZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.33 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-piperidin-4-yltriazol-4-yl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-piperidin-4-yltriazol-4-yl)pyridin-2-amine?
The IUPAC name of 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-piperidin-4-yltriazol-4-yl)pyridin-2-amine (CID 71621328) is 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-piperidin-4-yltriazol-4-yl)pyridin-2-amine.
What is the SMILES notation for 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-piperidin-4-yltriazol-4-yl)pyridin-2-amine?
The canonical SMILES for 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-piperidin-4-yltriazol-4-yl)pyridin-2-amine is CC(Oc1cc(-c2cn(C3CCNCC3)nn2)cnc1N)c1c(Cl)ccc(F)c1Cl.
What is the InChIKey of 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-piperidin-4-yltriazol-4-yl)pyridin-2-amine?
The InChIKey is NMJLXRYSZZFMOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21Cl2FN6O/c1-11(18-14(21)2-3-15(23)19(18)22)30-17-8-12(9-26-20(17)24)16-10-29(28-27-16)13-4-6-25-7-5-13/h2-3,8-11,13,25H,4-7H2,1H3,(H2,24,26).
What are the key properties of 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-piperidin-4-yltriazol-4-yl)pyridin-2-amine?
3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-piperidin-4-yltriazol-4-yl)pyridin-2-amine has a molecular weight of 451.33 g/mol, XLogP of 4.43, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-piperidin-4-yltriazol-4-yl)pyridin-2-amine is sourced from PubChem (CID 71621328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).