C21H12F6N6O2 — CID 71621368
2-[1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-5-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 71621368) has the molecular formula C21H12F6N6O2 and a molecular weight of 494.36 g/mol. Its IUPAC name is 2-[1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-5-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 2-[1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-5-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 71621368 |
| Molecular Formula | C21H12F6N6O2 |
| Molecular Weight | 494.36 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | 2-[1-[(2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-5-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | O=C1Nc2nc(-c3nn(Cc4ccccc4F)c4ncccc34)ncc2C1(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H12F6N6O2/c22-13-6-2-1-4-10(13)9-33-17-11(5-3-7-28-17)14(32-33)16-29-8-12-15(30-16)31-18(34)19(12,35)20(23,24)21(25,26)27/h1-8,35H,9H2,(H,29,30,31,34) |
| InChIKey | WFRBSRIRCNXQIO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|