C26H31N7O4S — CID 71621469
3-[4-[(4-methylphenyl)carbamoylamino]phenyl]-5-(3-morpholin-4-ylpropylcarbamoylamino)-1,2-thiazole-4-carboxamide (PubChem CID 71621469) has the molecular formula C26H31N7O4S and a molecular weight of 537.65 g/mol. Its IUPAC name is 3-[4-[(4-methylphenyl)carbamoylamino]phenyl]-5-(3-morpholin-4-ylpropylcarbamoylamino)-1,2-thiazole-4-carboxamide.
| Compound Name | 3-[4-[(4-methylphenyl)carbamoylamino]phenyl]-5-(3-morpholin-4-ylpropylcarbamoylamino)-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 71621469 |
| Molecular Formula | C26H31N7O4S |
| Molecular Weight | 537.65 g/mol |
| Exact Mass | 537.22 |
| IUPAC Name | 3-[4-[(4-methylphenyl)carbamoylamino]phenyl]-5-(3-morpholin-4-ylpropylcarbamoylamino)-1,2-thiazole-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(-c3nsc(NC(=O)NCCCN4CCOCC4)c3C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C26H31N7O4S/c1-17-3-7-19(8-4-17)29-26(36)30-20-9-5-18(6-10-20)22-21(23(27)34)24(38-32-22)31-25(35)28-11-2-12-33-13-15-37-16-14-33/h3-10H,2,11-16H2,1H3,(H2,27,34)(H2,28,31,35)(H2,29,30,36) |
| InChIKey | HHPVWJJNJSJOLQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 150.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.65 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|