C19H18F3N3O2S — CID 71621548
7-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]chromen-2-one (PubChem CID 71621548) has the molecular formula C19H18F3N3O2S and a molecular weight of 409.43 g/mol. Its IUPAC name is 7-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]chromen-2-one.
| Compound Name | 7-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]chromen-2-one |
|---|---|
| PubChem CID | 71621548 |
| Molecular Formula | C19H18F3N3O2S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 7-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]chromen-2-one |
| SMILES | C[C@@H]1CN(c2ccc3cc(-c4nc(C(F)(F)F)cs4)c(=O)oc3c2)C[C@H](C)N1 |
| InChI | InChI=1S/C19H18F3N3O2S/c1-10-7-25(8-11(2)23-10)13-4-3-12-5-14(18(26)27-15(12)6-13)17-24-16(9-28-17)19(20,21)22/h3-6,9-11,23H,7-8H2,1-2H3/t10-,11+ |
| InChIKey | YHYPIKUZSJOCDT-PHIMTYICSA-N |
| XLogP | 4.12 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|