C16H14N2O3 — CID 71621614
2-(imidazo[1,5-a]pyridin-8-ylmethoxy)-4-methoxybenzaldehyde (PubChem CID 71621614) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-(imidazo[1,5-a]pyridin-8-ylmethoxy)-4-methoxybenzaldehyde.
| Compound Name | 2-(imidazo[1,5-a]pyridin-8-ylmethoxy)-4-methoxybenzaldehyde |
|---|---|
| PubChem CID | 71621614 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-(imidazo[1,5-a]pyridin-8-ylmethoxy)-4-methoxybenzaldehyde |
| SMILES | COc1ccc(C=O)c(OCc2cccn3cncc23)c1 |
| InChI | InChI=1S/C16H14N2O3/c1-20-14-5-4-12(9-19)16(7-14)21-10-13-3-2-6-18-11-17-8-15(13)18/h2-9,11H,10H2,1H3 |
| InChIKey | OBVSYIPVNMKXQV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|