C21H17F2N7O — CID 71621682
3-[5-fluoro-1-[(2-fluoro-4-methylphenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-7,7-dimethyl-5H-pyrrolo[2,3-e][1,2,4]triazin-6-one (PubChem CID 71621682) has the molecular formula C21H17F2N7O and a molecular weight of 421.41 g/mol. Its IUPAC name is 3-[5-fluoro-1-[(2-fluoro-4-methylphenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-7,7-dimethyl-5H-pyrrolo[2,3-e][1,2,4]triazin-6-one.
| Compound Name | 3-[5-fluoro-1-[(2-fluoro-4-methylphenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-7,7-dimethyl-5H-pyrrolo[2,3-e][1,2,4]triazin-6-one |
|---|---|
| PubChem CID | 71621682 |
| Molecular Formula | C21H17F2N7O |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 3-[5-fluoro-1-[(2-fluoro-4-methylphenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-7,7-dimethyl-5H-pyrrolo[2,3-e][1,2,4]triazin-6-one |
| SMILES | Cc1ccc(Cn2nc(-c3nnc4c(n3)NC(=O)C4(C)C)c3cc(F)cnc32)c(F)c1 |
| InChI | InChI=1S/C21H17F2N7O/c1-10-4-5-11(14(23)6-10)9-30-19-13(7-12(22)8-24-19)15(29-30)17-25-18-16(27-28-17)21(2,3)20(31)26-18/h4-8H,9H2,1-3H3,(H,25,26,28,31) |
| InChIKey | JSWYKVFQCZUILL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |