C22H24N6O4S — CID 71621786
5-(3-hydroxypropylcarbamoylamino)-3-[4-[(4-methylphenyl)carbamoylamino]phenyl]-1,2-thiazole-4-carboxamide (PubChem CID 71621786) has the molecular formula C22H24N6O4S and a molecular weight of 468.54 g/mol. Its IUPAC name is 5-(3-hydroxypropylcarbamoylamino)-3-[4-[(4-methylphenyl)carbamoylamino]phenyl]-1,2-thiazole-4-carboxamide.
| Compound Name | 5-(3-hydroxypropylcarbamoylamino)-3-[4-[(4-methylphenyl)carbamoylamino]phenyl]-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 71621786 |
| Molecular Formula | C22H24N6O4S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 5-(3-hydroxypropylcarbamoylamino)-3-[4-[(4-methylphenyl)carbamoylamino]phenyl]-1,2-thiazole-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(-c3nsc(NC(=O)NCCCO)c3C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C22H24N6O4S/c1-13-3-7-15(8-4-13)25-22(32)26-16-9-5-14(6-10-16)18-17(19(23)30)20(33-28-18)27-21(31)24-11-2-12-29/h3-10,29H,2,11-12H2,1H3,(H2,23,30)(H2,24,27,31)(H2,25,26,32) |
| InChIKey | NNBXSFREJXVASG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 158.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|