C16H20N6 — CID 71622028
2-[(3aR,6aS)-5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]acetonitrile (PubChem CID 71622028) has the molecular formula C16H20N6 and a molecular weight of 296.38 g/mol. Its IUPAC name is 2-[(3aR,6aS)-5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]acetonitrile.
| Compound Name | 2-[(3aR,6aS)-5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]acetonitrile |
|---|---|
| PubChem CID | 71622028 |
| Molecular Formula | C16H20N6 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 2-[(3aR,6aS)-5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]acetonitrile |
| SMILES | CN(c1ncnc2[nH]ccc12)C1C[C@@H]2CN(CC#N)C[C@@H]2C1 |
| InChI | InChI=1S/C16H20N6/c1-21(16-14-2-4-18-15(14)19-10-20-16)13-6-11-8-22(5-3-17)9-12(11)7-13/h2,4,10-13H,5-9H2,1H3,(H,18,19,20)/t11-,12+,13? |
| InChIKey | VNVPUFSPTOLWEW-FUNVUKJBSA-N |
| XLogP | 1.63 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|