C22H30O6 — CID 71622032
2,3-dihydroxypropyl [(8R,9S,13S,14S,17R)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] carbonate (PubChem CID 71622032) has the molecular formula C22H30O6 and a molecular weight of 390.48 g/mol. Its IUPAC name is 2,3-dihydroxypropyl [(8R,9S,13S,14S,17R)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] carbonate.
| Compound Name | 2,3-dihydroxypropyl [(8R,9S,13S,14S,17R)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] carbonate |
|---|---|
| PubChem CID | 71622032 |
| Molecular Formula | C22H30O6 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 2,3-dihydroxypropyl [(8R,9S,13S,14S,17R)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] carbonate |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@H]2OC(=O)OCC(O)CO |
| InChI | InChI=1S/C22H30O6/c1-22-9-8-17-16-5-3-14(24)10-13(16)2-4-18(17)19(22)6-7-20(22)28-21(26)27-12-15(25)11-23/h3,5,10,15,17-20,23-25H,2,4,6-9,11-12H2,1H3/t15?,17-,18-,19+,20-,22+/m1/s1 |
| InChIKey | OSVXGVUWBRUYLZ-WQUSSPBPSA-N |
| XLogP | 3.12 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |