About 6-(hexylamino)-2,4,5-trimethylpyridin-3-ol
6-(hexylamino)-2,4,5-trimethylpyridin-3-ol (PubChem CID 71622386) has the molecular formula C14H24N2O
and a molecular weight of 236.36 g/mol. Its IUPAC name is 6-(hexylamino)-2,4,5-trimethylpyridin-3-ol.
Molecular Properties
| Compound Name | 6-(hexylamino)-2,4,5-trimethylpyridin-3-ol |
| PubChem CID | 71622386 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 6-(hexylamino)-2,4,5-trimethylpyridin-3-ol |
| SMILES | CCCCCCNc1nc(C)c(O)c(C)c1C |
| InChI | InChI=1S/C14H24N2O/c1-5-6-7-8-9-15-14-11(3)10(2)13(17)12(4)16-14/h17H,5-9H2,1-4H3,(H,15,16) |
| InChIKey | IAGAPJLNENGNGK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(hexylamino)-2,4,5-trimethylpyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(hexylamino)-2,4,5-trimethylpyridin-3-ol?
The IUPAC name of 6-(hexylamino)-2,4,5-trimethylpyridin-3-ol (CID 71622386) is 6-(hexylamino)-2,4,5-trimethylpyridin-3-ol.
What is the SMILES notation for 6-(hexylamino)-2,4,5-trimethylpyridin-3-ol?
The canonical SMILES for 6-(hexylamino)-2,4,5-trimethylpyridin-3-ol is CCCCCCNc1nc(C)c(O)c(C)c1C.
What is the InChIKey of 6-(hexylamino)-2,4,5-trimethylpyridin-3-ol?
The InChIKey is IAGAPJLNENGNGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O/c1-5-6-7-8-9-15-14-11(3)10(2)13(17)12(4)16-14/h17H,5-9H2,1-4H3,(H,15,16).
What are the key properties of 6-(hexylamino)-2,4,5-trimethylpyridin-3-ol?
6-(hexylamino)-2,4,5-trimethylpyridin-3-ol has a molecular weight of 236.36 g/mol, XLogP of 3.70, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(hexylamino)-2,4,5-trimethylpyridin-3-ol is sourced from PubChem (CID 71622386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).