About 3-imidazo[1,2-a]pyridin-2-yl-7-piperazin-1-ylchromen-2-one
3-imidazo[1,2-a]pyridin-2-yl-7-piperazin-1-ylchromen-2-one (PubChem CID 71622408) has the molecular formula C20H18N4O2
and a molecular weight of 346.39 g/mol. Its IUPAC name is 3-imidazo[1,2-a]pyridin-2-yl-7-piperazin-1-ylchromen-2-one.
Molecular Properties
| Compound Name | 3-imidazo[1,2-a]pyridin-2-yl-7-piperazin-1-ylchromen-2-one |
| PubChem CID | 71622408 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 3-imidazo[1,2-a]pyridin-2-yl-7-piperazin-1-ylchromen-2-one |
| SMILES | O=c1oc2cc(N3CCNCC3)ccc2cc1-c1cn2ccccc2n1 |
| InChI | InChI=1S/C20H18N4O2/c25-20-16(17-13-24-8-2-1-3-19(24)22-17)11-14-4-5-15(12-18(14)26-20)23-9-6-21-7-10-23/h1-5,8,11-13,21H,6-7,9-10H2 |
| InChIKey | ABKUPOMNBCNVRC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 62.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-imidazo[1,2-a]pyridin-2-yl-7-piperazin-1-ylchromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imidazo[1,2-a]pyridin-2-yl-7-piperazin-1-ylchromen-2-one?
The IUPAC name of 3-imidazo[1,2-a]pyridin-2-yl-7-piperazin-1-ylchromen-2-one (CID 71622408) is 3-imidazo[1,2-a]pyridin-2-yl-7-piperazin-1-ylchromen-2-one.
What is the SMILES notation for 3-imidazo[1,2-a]pyridin-2-yl-7-piperazin-1-ylchromen-2-one?
The canonical SMILES for 3-imidazo[1,2-a]pyridin-2-yl-7-piperazin-1-ylchromen-2-one is O=c1oc2cc(N3CCNCC3)ccc2cc1-c1cn2ccccc2n1.
What is the InChIKey of 3-imidazo[1,2-a]pyridin-2-yl-7-piperazin-1-ylchromen-2-one?
The InChIKey is ABKUPOMNBCNVRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4O2/c25-20-16(17-13-24-8-2-1-3-19(24)22-17)11-14-4-5-15(12-18(14)26-20)23-9-6-21-7-10-23/h1-5,8,11-13,21H,6-7,9-10H2.
What are the key properties of 3-imidazo[1,2-a]pyridin-2-yl-7-piperazin-1-ylchromen-2-one?
3-imidazo[1,2-a]pyridin-2-yl-7-piperazin-1-ylchromen-2-one has a molecular weight of 346.39 g/mol, XLogP of 2.52, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imidazo[1,2-a]pyridin-2-yl-7-piperazin-1-ylchromen-2-one is sourced from PubChem (CID 71622408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).