C21H21F3N4O4 — CID 71622451
2-(2-methoxyethoxy)-5-[[2-[2-(3,3,3-trifluoropropyl)pyrazol-3-yl]-3-pyridinyl]methoxy]pyridine-4-carbaldehyde (PubChem CID 71622451) has the molecular formula C21H21F3N4O4 and a molecular weight of 450.42 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-5-[[2-[2-(3,3,3-trifluoropropyl)pyrazol-3-yl]-3-pyridinyl]methoxy]pyridine-4-carbaldehyde.
| Compound Name | 2-(2-methoxyethoxy)-5-[[2-[2-(3,3,3-trifluoropropyl)pyrazol-3-yl]-3-pyridinyl]methoxy]pyridine-4-carbaldehyde |
|---|---|
| PubChem CID | 71622451 |
| Molecular Formula | C21H21F3N4O4 |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 2-(2-methoxyethoxy)-5-[[2-[2-(3,3,3-trifluoropropyl)pyrazol-3-yl]-3-pyridinyl]methoxy]pyridine-4-carbaldehyde |
| SMILES | COCCOc1cc(C=O)c(OCc2cccnc2-c2ccnn2CCC(F)(F)F)cn1 |
| InChI | InChI=1S/C21H21F3N4O4/c1-30-9-10-31-19-11-16(13-29)18(12-26-19)32-14-15-3-2-6-25-20(15)17-4-7-27-28(17)8-5-21(22,23)24/h2-4,6-7,11-13H,5,8-10,14H2,1H3 |
| InChIKey | IGVYVZCZWQCNHJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 88.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|