About methyl 6'-methyl-2'-pyridin-2-ylspiro[1,2-dihydroindene-3,4'-1H-pyrimidine]-5'-carboxylate
methyl 6'-methyl-2'-pyridin-2-ylspiro[1,2-dihydroindene-3,4'-1H-pyrimidine]-5'-carboxylate (PubChem CID 71622604) has the molecular formula C20H19N3O2
and a molecular weight of 333.39 g/mol. Its IUPAC name is methyl 6'-methyl-2'-pyridin-2-ylspiro[1,2-dihydroindene-3,4'-1H-pyrimidine]-5'-carboxylate.
Molecular Properties
| Compound Name | methyl 6'-methyl-2'-pyridin-2-ylspiro[1,2-dihydroindene-3,4'-1H-pyrimidine]-5'-carboxylate |
| PubChem CID | 71622604 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | methyl 6'-methyl-2'-pyridin-2-ylspiro[1,2-dihydroindene-3,4'-1H-pyrimidine]-5'-carboxylate |
| SMILES | COC(=O)C1=C(C)NC(c2ccccn2)=NC12CCc1ccccc12 |
| InChI | InChI=1S/C20H19N3O2/c1-13-17(19(24)25-2)20(11-10-14-7-3-4-8-15(14)20)23-18(22-13)16-9-5-6-12-21-16/h3-9,12H,10-11H2,1-2H3,(H,22,23) |
| InChIKey | HIMAHKMGPJVGCX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 6'-methyl-2'-pyridin-2-ylspiro[1,2-dihydroindene-3,4'-1H-pyrimidine]-5'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6'-methyl-2'-pyridin-2-ylspiro[1,2-dihydroindene-3,4'-1H-pyrimidine]-5'-carboxylate?
The IUPAC name of methyl 6'-methyl-2'-pyridin-2-ylspiro[1,2-dihydroindene-3,4'-1H-pyrimidine]-5'-carboxylate (CID 71622604) is methyl 6'-methyl-2'-pyridin-2-ylspiro[1,2-dihydroindene-3,4'-1H-pyrimidine]-5'-carboxylate.
What is the SMILES notation for methyl 6'-methyl-2'-pyridin-2-ylspiro[1,2-dihydroindene-3,4'-1H-pyrimidine]-5'-carboxylate?
The canonical SMILES for methyl 6'-methyl-2'-pyridin-2-ylspiro[1,2-dihydroindene-3,4'-1H-pyrimidine]-5'-carboxylate is COC(=O)C1=C(C)NC(c2ccccn2)=NC12CCc1ccccc12.
What is the InChIKey of methyl 6'-methyl-2'-pyridin-2-ylspiro[1,2-dihydroindene-3,4'-1H-pyrimidine]-5'-carboxylate?
The InChIKey is HIMAHKMGPJVGCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O2/c1-13-17(19(24)25-2)20(11-10-14-7-3-4-8-15(14)20)23-18(22-13)16-9-5-6-12-21-16/h3-9,12H,10-11H2,1-2H3,(H,22,23).
What are the key properties of methyl 6'-methyl-2'-pyridin-2-ylspiro[1,2-dihydroindene-3,4'-1H-pyrimidine]-5'-carboxylate?
methyl 6'-methyl-2'-pyridin-2-ylspiro[1,2-dihydroindene-3,4'-1H-pyrimidine]-5'-carboxylate has a molecular weight of 333.39 g/mol, XLogP of 2.72, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6'-methyl-2'-pyridin-2-ylspiro[1,2-dihydroindene-3,4'-1H-pyrimidine]-5'-carboxylate is sourced from PubChem (CID 71622604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).