About 3-(4-aminophenyl)-5-(3-methoxypropylcarbamoylamino)-1,2-thiazole-4-carboxamide
3-(4-aminophenyl)-5-(3-methoxypropylcarbamoylamino)-1,2-thiazole-4-carboxamide (PubChem CID 71623031) has the molecular formula C15H19N5O3S
and a molecular weight of 349.42 g/mol. Its IUPAC name is 3-(4-aminophenyl)-5-(3-methoxypropylcarbamoylamino)-1,2-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 3-(4-aminophenyl)-5-(3-methoxypropylcarbamoylamino)-1,2-thiazole-4-carboxamide |
| PubChem CID | 71623031 |
| Molecular Formula | C15H19N5O3S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 3-(4-aminophenyl)-5-(3-methoxypropylcarbamoylamino)-1,2-thiazole-4-carboxamide |
| SMILES | COCCCNC(=O)Nc1snc(-c2ccc(N)cc2)c1C(N)=O |
| InChI | InChI=1S/C15H19N5O3S/c1-23-8-2-7-18-15(22)19-14-11(13(17)21)12(20-24-14)9-3-5-10(16)6-4-9/h3-6H,2,7-8,16H2,1H3,(H2,17,21)(H2,18,19,22) |
| InChIKey | LDCQPCHMNOJESG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 132.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-aminophenyl)-5-(3-methoxypropylcarbamoylamino)-1,2-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-aminophenyl)-5-(3-methoxypropylcarbamoylamino)-1,2-thiazole-4-carboxamide?
The IUPAC name of 3-(4-aminophenyl)-5-(3-methoxypropylcarbamoylamino)-1,2-thiazole-4-carboxamide (CID 71623031) is 3-(4-aminophenyl)-5-(3-methoxypropylcarbamoylamino)-1,2-thiazole-4-carboxamide.
What is the SMILES notation for 3-(4-aminophenyl)-5-(3-methoxypropylcarbamoylamino)-1,2-thiazole-4-carboxamide?
The canonical SMILES for 3-(4-aminophenyl)-5-(3-methoxypropylcarbamoylamino)-1,2-thiazole-4-carboxamide is COCCCNC(=O)Nc1snc(-c2ccc(N)cc2)c1C(N)=O.
What is the InChIKey of 3-(4-aminophenyl)-5-(3-methoxypropylcarbamoylamino)-1,2-thiazole-4-carboxamide?
The InChIKey is LDCQPCHMNOJESG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N5O3S/c1-23-8-2-7-18-15(22)19-14-11(13(17)21)12(20-24-14)9-3-5-10(16)6-4-9/h3-6H,2,7-8,16H2,1H3,(H2,17,21)(H2,18,19,22).
What are the key properties of 3-(4-aminophenyl)-5-(3-methoxypropylcarbamoylamino)-1,2-thiazole-4-carboxamide?
3-(4-aminophenyl)-5-(3-methoxypropylcarbamoylamino)-1,2-thiazole-4-carboxamide has a molecular weight of 349.42 g/mol, XLogP of 1.65, 7 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-aminophenyl)-5-(3-methoxypropylcarbamoylamino)-1,2-thiazole-4-carboxamide is sourced from PubChem (CID 71623031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).