C25H30N2OSi — CID 71623296
(1R,9S,10S,11R)-10-[dimethyl(phenyl)silyl]-13-ethylidene-5-methoxy-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-1-carbonitrile (PubChem CID 71623296) has the molecular formula C25H30N2OSi and a molecular weight of 402.61 g/mol. Its IUPAC name is (1R,9S,10S,11R)-10-[dimethyl(phenyl)silyl]-13-ethylidene-5-methoxy-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-1-carbonitrile.
| Compound Name | (1R,9S,10S,11R)-10-[dimethyl(phenyl)silyl]-13-ethylidene-5-methoxy-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-1-carbonitrile |
|---|---|
| PubChem CID | 71623296 |
| Molecular Formula | C25H30N2OSi |
| Molecular Weight | 402.61 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | (1R,9S,10S,11R)-10-[dimethyl(phenyl)silyl]-13-ethylidene-5-methoxy-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-1-carbonitrile |
| SMILES | CC=C1[C@@H]2Cc3nc(OC)ccc3[C@@]1(C#N)C[C@@H](C)[C@@H]2[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C25H30N2OSi/c1-6-20-19-14-22-21(12-13-23(27-22)28-3)25(20,16-26)15-17(2)24(19)29(4,5)18-10-8-7-9-11-18/h6-13,17,19,24H,14-15H2,1-5H3/t17-,19+,24+,25-/m1/s1 |
| InChIKey | YMMXRBXJRXYIMQ-VRCHSZTHSA-N |
| XLogP | 5.00 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.61 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|