C11H13F3N2O5 — CID 71623421
(2,5-dioxopyrrolidin-1-yl) (2R)-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butanoate (PubChem CID 71623421) has the molecular formula C11H13F3N2O5 and a molecular weight of 310.23 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (2R)-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (2R)-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butanoate |
|---|---|
| PubChem CID | 71623421 |
| Molecular Formula | C11H13F3N2O5 |
| Molecular Weight | 310.23 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (2R)-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butanoate |
| SMILES | CC(C)[C@@H](NC(=O)C(F)(F)F)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C11H13F3N2O5/c1-5(2)8(15-10(20)11(12,13)14)9(19)21-16-6(17)3-4-7(16)18/h5,8H,3-4H2,1-2H3,(H,15,20)/t8-/m1/s1 |
| InChIKey | GJXSOCPIVZYOAU-MRVPVSSYSA-N |
| XLogP | 0.30 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.23 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|