C16H23Br — CID 71623652
(2R,7R,11S,12S)-1-(2-bromoethyl)pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane (PubChem CID 71623652) has the molecular formula C16H23Br and a molecular weight of 295.26 g/mol. Its IUPAC name is (2R,7R,11S,12S)-1-(2-bromoethyl)pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane.
| Compound Name | (2R,7R,11S,12S)-1-(2-bromoethyl)pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane |
|---|---|
| PubChem CID | 71623652 |
| Molecular Formula | C16H23Br |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | (2R,7R,11S,12S)-1-(2-bromoethyl)pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane |
| SMILES | BrCCC12CC3C[C@@H]4C5CC(C[C@H]41)C[C@H]2[C@H]5C3 |
| InChI | InChI=1S/C16H23Br/c17-2-1-16-8-10-4-12-11-3-9(6-14(12)16)7-15(16)13(11)5-10/h9-15H,1-8H2/t9?,10?,11?,12-,13+,14-,15+,16? |
| InChIKey | ZGMRBIVPUAEYKS-RHXADBCNSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|