C14H14O5 — CID 71623807
(1R,10R,13R)-13-methyl-9,14,15,17-tetraoxatetracyclo[11.2.2.01,10.02,7]heptadeca-2,4,6-trien-8-one (PubChem CID 71623807) has the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. Its IUPAC name is (1R,10R,13R)-13-methyl-9,14,15,17-tetraoxatetracyclo[11.2.2.01,10.02,7]heptadeca-2,4,6-trien-8-one.
| Compound Name | (1R,10R,13R)-13-methyl-9,14,15,17-tetraoxatetracyclo[11.2.2.01,10.02,7]heptadeca-2,4,6-trien-8-one |
|---|---|
| PubChem CID | 71623807 |
| Molecular Formula | C14H14O5 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | (1R,10R,13R)-13-methyl-9,14,15,17-tetraoxatetracyclo[11.2.2.01,10.02,7]heptadeca-2,4,6-trien-8-one |
| SMILES | C[C@@]12CC[C@H]3OC(=O)c4ccccc4[C@]3(CO1)OO2 |
| InChI | InChI=1S/C14H14O5/c1-13-7-6-11-14(8-16-13,19-18-13)10-5-3-2-4-9(10)12(15)17-11/h2-5,11H,6-8H2,1H3/t11-,13-,14+/m1/s1 |
| InChIKey | YVKQBWPQYADLSR-BNOWGMLFSA-N |
| XLogP | 1.91 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|