About sodium (Z)-1-ethoxy-2-fluoro-4-methoxy-3,4-dioxobut-1-en-1-olate
sodium (Z)-1-ethoxy-2-fluoro-4-methoxy-3,4-dioxobut-1-en-1-olate (PubChem CID 71623950) has the molecular formula C7H8FNaO5
and a molecular weight of 214.12 g/mol. Its IUPAC name is sodium (Z)-1-ethoxy-2-fluoro-4-methoxy-3,4-dioxobut-1-en-1-olate.
Molecular Properties
| Compound Name | sodium (Z)-1-ethoxy-2-fluoro-4-methoxy-3,4-dioxobut-1-en-1-olate |
| PubChem CID | 71623950 |
| Molecular Formula | C7H8FNaO5 |
| Molecular Weight | 214.12 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | sodium (Z)-1-ethoxy-2-fluoro-4-methoxy-3,4-dioxobut-1-en-1-olate |
| SMILES | CCO/C([O-])=C(\F)C(=O)C(=O)OC.[Na+] |
| InChI | InChI=1S/C7H9FO5.Na/c1-3-13-6(10)4(8)5(9)7(11)12-2;/h10H,3H2,1-2H3;/q;+1/p-1/b6-4-; |
| InChIKey | YADNRQKDTYCRRB-YHSAGPEESA-M |
| XLogP | -3.73 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.12 |
| LogP ≤ 5 | -3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze sodium (Z)-1-ethoxy-2-fluoro-4-methoxy-3,4-dioxobut-1-en-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium (Z)-1-ethoxy-2-fluoro-4-methoxy-3,4-dioxobut-1-en-1-olate?
The IUPAC name of sodium (Z)-1-ethoxy-2-fluoro-4-methoxy-3,4-dioxobut-1-en-1-olate (CID 71623950) is sodium (Z)-1-ethoxy-2-fluoro-4-methoxy-3,4-dioxobut-1-en-1-olate.
What is the SMILES notation for sodium (Z)-1-ethoxy-2-fluoro-4-methoxy-3,4-dioxobut-1-en-1-olate?
The canonical SMILES for sodium (Z)-1-ethoxy-2-fluoro-4-methoxy-3,4-dioxobut-1-en-1-olate is CCO/C([O-])=C(\F)C(=O)C(=O)OC.[Na+].
What is the InChIKey of sodium (Z)-1-ethoxy-2-fluoro-4-methoxy-3,4-dioxobut-1-en-1-olate?
The InChIKey is YADNRQKDTYCRRB-YHSAGPEESA-M. The full InChI is InChI=1S/C7H9FO5.Na/c1-3-13-6(10)4(8)5(9)7(11)12-2;/h10H,3H2,1-2H3;/q;+1/p-1/b6-4-;.
What are the key properties of sodium (Z)-1-ethoxy-2-fluoro-4-methoxy-3,4-dioxobut-1-en-1-olate?
sodium (Z)-1-ethoxy-2-fluoro-4-methoxy-3,4-dioxobut-1-en-1-olate has a molecular weight of 214.12 g/mol, XLogP of -3.73, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium (Z)-1-ethoxy-2-fluoro-4-methoxy-3,4-dioxobut-1-en-1-olate is sourced from PubChem (CID 71623950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).