C36H34O7 — CID 71623988
4-(3,6-dimethoxy-1,1,7-trimethyl-2-oxophenanthren-9-yl)oxy-8-methoxy-3,3,7-trimethylcyclopenta[a]naphthalene-2,5-dione (PubChem CID 71623988) has the molecular formula C36H34O7 and a molecular weight of 578.66 g/mol. Its IUPAC name is 4-(3,6-dimethoxy-1,1,7-trimethyl-2-oxophenanthren-9-yl)oxy-8-methoxy-3,3,7-trimethylcyclopenta[a]naphthalene-2,5-dione.
| Compound Name | 4-(3,6-dimethoxy-1,1,7-trimethyl-2-oxophenanthren-9-yl)oxy-8-methoxy-3,3,7-trimethylcyclopenta[a]naphthalene-2,5-dione |
|---|---|
| PubChem CID | 71623988 |
| Molecular Formula | C36H34O7 |
| Molecular Weight | 578.66 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | 4-(3,6-dimethoxy-1,1,7-trimethyl-2-oxophenanthren-9-yl)oxy-8-methoxy-3,3,7-trimethylcyclopenta[a]naphthalene-2,5-dione |
| SMILES | COC1=Cc2c(cc(OC3=C4C(=CC(=O)C4(C)C)c4cc(OC)c(C)cc4C3=O)c3cc(C)c(OC)cc23)C(C)(C)C1=O |
| InChI | InChI=1S/C36H34O7/c1-17-10-22-19(12-26(17)40-7)21-14-29(42-9)34(39)35(3,4)25(21)16-28(22)43-33-31-23(15-30(37)36(31,5)6)20-13-27(41-8)18(2)11-24(20)32(33)38/h10-16H,1-9H3 |
| InChIKey | GOAXONQUIUAYOC-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.66 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |