C22H26N2O3 — CID 71624715
[(E)-(3-ethyl-1-methyl-2,6-diphenylpiperidin-4-ylidene)amino] methyl carbonate (PubChem CID 71624715) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is [(E)-(3-ethyl-1-methyl-2,6-diphenylpiperidin-4-ylidene)amino] methyl carbonate.
| Compound Name | [(E)-(3-ethyl-1-methyl-2,6-diphenylpiperidin-4-ylidene)amino] methyl carbonate |
|---|---|
| PubChem CID | 71624715 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | [(E)-(3-ethyl-1-methyl-2,6-diphenylpiperidin-4-ylidene)amino] methyl carbonate |
| SMILES | CCC1/C(=N/OC(=O)OC)CC(c2ccccc2)N(C)C1c1ccccc1 |
| InChI | InChI=1S/C22H26N2O3/c1-4-18-19(23-27-22(25)26-3)15-20(16-11-7-5-8-12-16)24(2)21(18)17-13-9-6-10-14-17/h5-14,18,20-21H,4,15H2,1-3H3/b23-19+ |
| InChIKey | FFQSWSIEINCATO-FCDQGJHFSA-N |
| XLogP | 4.97 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|