C22H21N3O2 — CID 71624845
2-[4-[(2-phenyl-5,6,7,8-tetrahydroquinazolin-4-yl)amino]phenyl]acetic acid (PubChem CID 71624845) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-[4-[(2-phenyl-5,6,7,8-tetrahydroquinazolin-4-yl)amino]phenyl]acetic acid.
| Compound Name | 2-[4-[(2-phenyl-5,6,7,8-tetrahydroquinazolin-4-yl)amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 71624845 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 2-[4-[(2-phenyl-5,6,7,8-tetrahydroquinazolin-4-yl)amino]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(Nc2nc(-c3ccccc3)nc3c2CCCC3)cc1 |
| InChI | InChI=1S/C22H21N3O2/c26-20(27)14-15-10-12-17(13-11-15)23-22-18-8-4-5-9-19(18)24-21(25-22)16-6-2-1-3-7-16/h1-3,6-7,10-13H,4-5,8-9,14H2,(H,26,27)(H,23,24,25) |
| InChIKey | ROFPRJBLRBBBHM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |