About 4-[(2R,5R)-1-benzyl-5-methylpiperazin-2-yl]butan-1-ol
4-[(2R,5R)-1-benzyl-5-methylpiperazin-2-yl]butan-1-ol (PubChem CID 71625219) has the molecular formula C16H26N2O
and a molecular weight of 262.40 g/mol. Its IUPAC name is 4-[(2R,5R)-1-benzyl-5-methylpiperazin-2-yl]butan-1-ol.
Molecular Properties
| Compound Name | 4-[(2R,5R)-1-benzyl-5-methylpiperazin-2-yl]butan-1-ol |
| PubChem CID | 71625219 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 4-[(2R,5R)-1-benzyl-5-methylpiperazin-2-yl]butan-1-ol |
| SMILES | C[C@@H]1CN(Cc2ccccc2)[C@H](CCCCO)CN1 |
| InChI | InChI=1S/C16H26N2O/c1-14-12-18(13-15-7-3-2-4-8-15)16(11-17-14)9-5-6-10-19/h2-4,7-8,14,16-17,19H,5-6,9-13H2,1H3/t14-,16-/m1/s1 |
| InChIKey | ZXNRHUVFDCSHQA-GDBMZVCRSA-N |
| XLogP | 2.01 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2R,5R)-1-benzyl-5-methylpiperazin-2-yl]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R,5R)-1-benzyl-5-methylpiperazin-2-yl]butan-1-ol?
The IUPAC name of 4-[(2R,5R)-1-benzyl-5-methylpiperazin-2-yl]butan-1-ol (CID 71625219) is 4-[(2R,5R)-1-benzyl-5-methylpiperazin-2-yl]butan-1-ol.
What is the SMILES notation for 4-[(2R,5R)-1-benzyl-5-methylpiperazin-2-yl]butan-1-ol?
The canonical SMILES for 4-[(2R,5R)-1-benzyl-5-methylpiperazin-2-yl]butan-1-ol is C[C@@H]1CN(Cc2ccccc2)[C@H](CCCCO)CN1.
What is the InChIKey of 4-[(2R,5R)-1-benzyl-5-methylpiperazin-2-yl]butan-1-ol?
The InChIKey is ZXNRHUVFDCSHQA-GDBMZVCRSA-N. The full InChI is InChI=1S/C16H26N2O/c1-14-12-18(13-15-7-3-2-4-8-15)16(11-17-14)9-5-6-10-19/h2-4,7-8,14,16-17,19H,5-6,9-13H2,1H3/t14-,16-/m1/s1.
What are the key properties of 4-[(2R,5R)-1-benzyl-5-methylpiperazin-2-yl]butan-1-ol?
4-[(2R,5R)-1-benzyl-5-methylpiperazin-2-yl]butan-1-ol has a molecular weight of 262.40 g/mol, XLogP of 2.01, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R,5R)-1-benzyl-5-methylpiperazin-2-yl]butan-1-ol is sourced from PubChem (CID 71625219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).