C18H17N7O3 — CID 71625252
[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]phenyl] acetate (PubChem CID 71625252) has the molecular formula C18H17N7O3 and a molecular weight of 379.38 g/mol. Its IUPAC name is [4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]phenyl] acetate.
| Compound Name | [4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]phenyl] acetate |
|---|---|
| PubChem CID | 71625252 |
| Molecular Formula | C18H17N7O3 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | [4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(CCNc2nc(N)n3nc(-c4ccco4)nc3n2)cc1 |
| InChI | InChI=1S/C18H17N7O3/c1-11(26)28-13-6-4-12(5-7-13)8-9-20-17-22-16(19)25-18(23-17)21-15(24-25)14-3-2-10-27-14/h2-7,10H,8-9H2,1H3,(H3,19,20,21,22,23,24) |
| InChIKey | JJGNQMWLQQRWSF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 133.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|