C26H33N7O3 — CID 71625253
[4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]phenyl] decanoate (PubChem CID 71625253) has the molecular formula C26H33N7O3 and a molecular weight of 491.60 g/mol. Its IUPAC name is [4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]phenyl] decanoate.
| Compound Name | [4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]phenyl] decanoate |
|---|---|
| PubChem CID | 71625253 |
| Molecular Formula | C26H33N7O3 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | [4-[2-[[7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-yl]amino]ethyl]phenyl] decanoate |
| SMILES | CCCCCCCCCC(=O)Oc1ccc(CCNc2nc(N)n3nc(-c4ccco4)nc3n2)cc1 |
| InChI | InChI=1S/C26H33N7O3/c1-2-3-4-5-6-7-8-11-22(34)36-20-14-12-19(13-15-20)16-17-28-25-30-24(27)33-26(31-25)29-23(32-33)21-10-9-18-35-21/h9-10,12-15,18H,2-8,11,16-17H2,1H3,(H3,27,28,29,30,31,32) |
| InChIKey | CTYRXMVWPLIBKU-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 133.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|