C18H14N4O2S — CID 71625441
(E)-N-hydroxy-3-[2-(pyridin-3-ylamino)-4H-indeno[1,2-d][1,3]thiazol-6-yl]prop-2-enamide (PubChem CID 71625441) has the molecular formula C18H14N4O2S and a molecular weight of 350.40 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[2-(pyridin-3-ylamino)-4H-indeno[1,2-d][1,3]thiazol-6-yl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[2-(pyridin-3-ylamino)-4H-indeno[1,2-d][1,3]thiazol-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 71625441 |
| Molecular Formula | C18H14N4O2S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | (E)-N-hydroxy-3-[2-(pyridin-3-ylamino)-4H-indeno[1,2-d][1,3]thiazol-6-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)Cc1sc(Nc3cccnc3)nc1-2)NO |
| InChI | InChI=1S/C18H14N4O2S/c23-16(22-24)6-4-11-3-5-14-12(8-11)9-15-17(14)21-18(25-15)20-13-2-1-7-19-10-13/h1-8,10,24H,9H2,(H,20,21)(H,22,23)/b6-4+ |
| InChIKey | KJRFBPIEQZTTCN-GQCTYLIASA-N |
| XLogP | 3.37 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|