About 3-[3-(3,5-dichlorophenyl)sulfanyl-6-methyl-1H-indol-2-yl]propanamide
3-[3-(3,5-dichlorophenyl)sulfanyl-6-methyl-1H-indol-2-yl]propanamide (PubChem CID 71625872) has the molecular formula C18H16Cl2N2OS
and a molecular weight of 379.31 g/mol. Its IUPAC name is 3-[3-(3,5-dichlorophenyl)sulfanyl-6-methyl-1H-indol-2-yl]propanamide.
Molecular Properties
| Compound Name | 3-[3-(3,5-dichlorophenyl)sulfanyl-6-methyl-1H-indol-2-yl]propanamide |
| PubChem CID | 71625872 |
| Molecular Formula | C18H16Cl2N2OS |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 3-[3-(3,5-dichlorophenyl)sulfanyl-6-methyl-1H-indol-2-yl]propanamide |
| SMILES | Cc1ccc2c(Sc3cc(Cl)cc(Cl)c3)c(CCC(N)=O)[nH]c2c1 |
| InChI | InChI=1S/C18H16Cl2N2OS/c1-10-2-3-14-16(6-10)22-15(4-5-17(21)23)18(14)24-13-8-11(19)7-12(20)9-13/h2-3,6-9,22H,4-5H2,1H3,(H2,21,23) |
| InChIKey | BUCMJAVKKILLJB-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[3-(3,5-dichlorophenyl)sulfanyl-6-methyl-1H-indol-2-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(3,5-dichlorophenyl)sulfanyl-6-methyl-1H-indol-2-yl]propanamide?
The IUPAC name of 3-[3-(3,5-dichlorophenyl)sulfanyl-6-methyl-1H-indol-2-yl]propanamide (CID 71625872) is 3-[3-(3,5-dichlorophenyl)sulfanyl-6-methyl-1H-indol-2-yl]propanamide.
What is the SMILES notation for 3-[3-(3,5-dichlorophenyl)sulfanyl-6-methyl-1H-indol-2-yl]propanamide?
The canonical SMILES for 3-[3-(3,5-dichlorophenyl)sulfanyl-6-methyl-1H-indol-2-yl]propanamide is Cc1ccc2c(Sc3cc(Cl)cc(Cl)c3)c(CCC(N)=O)[nH]c2c1.
What is the InChIKey of 3-[3-(3,5-dichlorophenyl)sulfanyl-6-methyl-1H-indol-2-yl]propanamide?
The InChIKey is BUCMJAVKKILLJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16Cl2N2OS/c1-10-2-3-14-16(6-10)22-15(4-5-17(21)23)18(14)24-13-8-11(19)7-12(20)9-13/h2-3,6-9,22H,4-5H2,1H3,(H2,21,23).
What are the key properties of 3-[3-(3,5-dichlorophenyl)sulfanyl-6-methyl-1H-indol-2-yl]propanamide?
3-[3-(3,5-dichlorophenyl)sulfanyl-6-methyl-1H-indol-2-yl]propanamide has a molecular weight of 379.31 g/mol, XLogP of 5.35, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(3,5-dichlorophenyl)sulfanyl-6-methyl-1H-indol-2-yl]propanamide is sourced from PubChem (CID 71625872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).