About (4-methoxyphenyl)-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]methanone
(4-methoxyphenyl)-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]methanone (PubChem CID 71625876) has the molecular formula C20H20N2O5
and a molecular weight of 368.39 g/mol. Its IUPAC name is (4-methoxyphenyl)-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]methanone.
Molecular Properties
| Compound Name | (4-methoxyphenyl)-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]methanone |
| PubChem CID | 71625876 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | (4-methoxyphenyl)-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]methanone |
| SMILES | COc1ccc(C(=O)c2ncc(-c3cc(OC)c(OC)c(OC)c3)[nH]2)cc1 |
| InChI | InChI=1S/C20H20N2O5/c1-24-14-7-5-12(6-8-14)18(23)20-21-11-15(22-20)13-9-16(25-2)19(27-4)17(10-13)26-3/h5-11H,1-4H3,(H,21,22) |
| InChIKey | ALFGOGXVFFGDHQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 82.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4-methoxyphenyl)-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl)-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]methanone?
The IUPAC name of (4-methoxyphenyl)-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]methanone (CID 71625876) is (4-methoxyphenyl)-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]methanone.
What is the SMILES notation for (4-methoxyphenyl)-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]methanone?
The canonical SMILES for (4-methoxyphenyl)-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]methanone is COc1ccc(C(=O)c2ncc(-c3cc(OC)c(OC)c(OC)c3)[nH]2)cc1.
What is the InChIKey of (4-methoxyphenyl)-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]methanone?
The InChIKey is ALFGOGXVFFGDHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O5/c1-24-14-7-5-12(6-8-14)18(23)20-21-11-15(22-20)13-9-16(25-2)19(27-4)17(10-13)26-3/h5-11H,1-4H3,(H,21,22).
What are the key properties of (4-methoxyphenyl)-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]methanone?
(4-methoxyphenyl)-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]methanone has a molecular weight of 368.39 g/mol, XLogP of 3.34, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl)-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]methanone is sourced from PubChem (CID 71625876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).