C21H19F9N4O — CID 71626284
3-[7-methyl-5-(trifluoromethyl)-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-bis(2,2,2-trifluoroethyl)urea (PubChem CID 71626284) has the molecular formula C21H19F9N4O and a molecular weight of 514.39 g/mol. Its IUPAC name is 3-[7-methyl-5-(trifluoromethyl)-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-bis(2,2,2-trifluoroethyl)urea.
| Compound Name | 3-[7-methyl-5-(trifluoromethyl)-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-bis(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 71626284 |
| Molecular Formula | C21H19F9N4O |
| Molecular Weight | 514.39 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 3-[7-methyl-5-(trifluoromethyl)-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-bis(2,2,2-trifluoroethyl)urea |
| SMILES | CN1CC(NC(=O)N(CC(F)(F)F)CC(F)(F)F)C=C2c3cccc4[nH]c(C(F)(F)F)c(c34)CC21 |
| InChI | InChI=1S/C21H19F9N4O/c1-33-7-10(31-18(35)34(8-19(22,23)24)9-20(25,26)27)5-12-11-3-2-4-14-16(11)13(6-15(12)33)17(32-14)21(28,29)30/h2-5,10,15,32H,6-9H2,1H3,(H,31,35) |
| InChIKey | ZIIGSFYZVHCGJM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.39 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |