C21H15F13N4O — CID 71626285
3-[7-methyl-5-(trifluoromethyl)-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-bis(1,1,2,2,2-pentafluoroethyl)urea (PubChem CID 71626285) has the molecular formula C21H15F13N4O and a molecular weight of 586.35 g/mol. Its IUPAC name is 3-[7-methyl-5-(trifluoromethyl)-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-bis(1,1,2,2,2-pentafluoroethyl)urea.
| Compound Name | 3-[7-methyl-5-(trifluoromethyl)-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-bis(1,1,2,2,2-pentafluoroethyl)urea |
|---|---|
| PubChem CID | 71626285 |
| Molecular Formula | C21H15F13N4O |
| Molecular Weight | 586.35 g/mol |
| Exact Mass | 586.10 |
| IUPAC Name | 3-[7-methyl-5-(trifluoromethyl)-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-bis(1,1,2,2,2-pentafluoroethyl)urea |
| SMILES | CN1CC(NC(=O)N(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F)C=C2c3cccc4[nH]c(C(F)(F)F)c(c34)CC21 |
| InChI | InChI=1S/C21H15F13N4O/c1-37-7-8(35-16(39)38(20(31,32)18(25,26)27)21(33,34)19(28,29)30)5-10-9-3-2-4-12-14(9)11(6-13(10)37)15(36-12)17(22,23)24/h2-5,8,13,36H,6-7H2,1H3,(H,35,39) |
| InChIKey | FVGBICZCLQJQJX-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.35 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|