C20H22F6N4O — CID 71626286
3-(7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl)-1,1-bis(2,2,2-trifluoroethyl)urea (PubChem CID 71626286) has the molecular formula C20H22F6N4O and a molecular weight of 448.41 g/mol. Its IUPAC name is 3-(7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl)-1,1-bis(2,2,2-trifluoroethyl)urea.
| Compound Name | 3-(7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl)-1,1-bis(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 71626286 |
| Molecular Formula | C20H22F6N4O |
| Molecular Weight | 448.41 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 3-(7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl)-1,1-bis(2,2,2-trifluoroethyl)urea |
| SMILES | CN1CC(NC(=O)N(CC(F)(F)F)CC(F)(F)F)CC2c3cccc4[nH]cc(c34)CC21 |
| InChI | InChI=1S/C20H22F6N4O/c1-29-8-12(28-18(31)30(9-19(21,22)23)10-20(24,25)26)6-14-13-3-2-4-15-17(13)11(7-27-15)5-16(14)29/h2-4,7,12,14,16,27H,5-6,8-10H2,1H3,(H,28,31) |
| InChIKey | QNWYQKJNBMTRDZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |