About methyl N-dec-9-enylcarbamate
methyl N-dec-9-enylcarbamate (PubChem CID 71626320) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is methyl N-dec-9-enylcarbamate.
Molecular Properties
| Compound Name | methyl N-dec-9-enylcarbamate |
| PubChem CID | 71626320 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | methyl N-dec-9-enylcarbamate |
| SMILES | C=CCCCCCCCCNC(=O)OC |
| InChI | InChI=1S/C12H23NO2/c1-3-4-5-6-7-8-9-10-11-13-12(14)15-2/h3H,1,4-11H2,2H3,(H,13,14) |
| InChIKey | MAMIIHYYHCEIAQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl N-dec-9-enylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-dec-9-enylcarbamate?
The IUPAC name of methyl N-dec-9-enylcarbamate (CID 71626320) is methyl N-dec-9-enylcarbamate.
What is the SMILES notation for methyl N-dec-9-enylcarbamate?
The canonical SMILES for methyl N-dec-9-enylcarbamate is C=CCCCCCCCCNC(=O)OC.
What is the InChIKey of methyl N-dec-9-enylcarbamate?
The InChIKey is MAMIIHYYHCEIAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2/c1-3-4-5-6-7-8-9-10-11-13-12(14)15-2/h3H,1,4-11H2,2H3,(H,13,14).
What are the key properties of methyl N-dec-9-enylcarbamate?
methyl N-dec-9-enylcarbamate has a molecular weight of 213.32 g/mol, XLogP of 3.26, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-dec-9-enylcarbamate is sourced from PubChem (CID 71626320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).