C20H18F10N4O — CID 71626346
3-(7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl)-1,1-bis(1,1,2,2,2-pentafluoroethyl)urea (PubChem CID 71626346) has the molecular formula C20H18F10N4O and a molecular weight of 520.37 g/mol. Its IUPAC name is 3-(7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl)-1,1-bis(1,1,2,2,2-pentafluoroethyl)urea.
| Compound Name | 3-(7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl)-1,1-bis(1,1,2,2,2-pentafluoroethyl)urea |
|---|---|
| PubChem CID | 71626346 |
| Molecular Formula | C20H18F10N4O |
| Molecular Weight | 520.37 g/mol |
| Exact Mass | 520.13 |
| IUPAC Name | 3-(7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl)-1,1-bis(1,1,2,2,2-pentafluoroethyl)urea |
| SMILES | CN1CC(NC(=O)N(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F)CC2c3cccc4[nH]cc(c34)CC21 |
| InChI | InChI=1S/C20H18F10N4O/c1-33-8-10(6-12-11-3-2-4-13-15(11)9(7-31-13)5-14(12)33)32-16(35)34(19(27,28)17(21,22)23)20(29,30)18(24,25)26/h2-4,7,10,12,14,31H,5-6,8H2,1H3,(H,32,35) |
| InChIKey | UTIGYNSXCJWASI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.37 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|