C18H17N7O2S2 — CID 71626967
2-[[(3R,4R)-3-aminooxan-4-yl]amino]-N-([1,3]thiazolo[4,5-b]pyridin-2-yl)thieno[3,2-d]pyrimidine-7-carboxamide (PubChem CID 71626967) has the molecular formula C18H17N7O2S2 and a molecular weight of 427.52 g/mol. Its IUPAC name is 2-[[(3R,4R)-3-aminooxan-4-yl]amino]-N-([1,3]thiazolo[4,5-b]pyridin-2-yl)thieno[3,2-d]pyrimidine-7-carboxamide.
| Compound Name | 2-[[(3R,4R)-3-aminooxan-4-yl]amino]-N-([1,3]thiazolo[4,5-b]pyridin-2-yl)thieno[3,2-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 71626967 |
| Molecular Formula | C18H17N7O2S2 |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 2-[[(3R,4R)-3-aminooxan-4-yl]amino]-N-([1,3]thiazolo[4,5-b]pyridin-2-yl)thieno[3,2-d]pyrimidine-7-carboxamide |
| SMILES | N[C@H]1COCC[C@H]1Nc1ncc2scc(C(=O)Nc3nc4ncccc4s3)c2n1 |
| InChI | InChI=1S/C18H17N7O2S2/c19-10-7-27-5-3-11(10)22-17-21-6-13-14(23-17)9(8-28-13)16(26)25-18-24-15-12(29-18)2-1-4-20-15/h1-2,4,6,8,10-11H,3,5,7,19H2,(H,21,22,23)(H,20,24,25,26)/t10-,11+/m0/s1 |
| InChIKey | IADPDEZMXPLQIG-WDEREUQCSA-N |
| XLogP | 2.48 |
| TPSA | 127.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |