About methyl 4-[(1,4-dimethylpiperazin-2-ylidene)amino]-3-(phenylcarbamoyl)benzoate
methyl 4-[(1,4-dimethylpiperazin-2-ylidene)amino]-3-(phenylcarbamoyl)benzoate (PubChem CID 71627328) has the molecular formula C21H24N4O3
and a molecular weight of 380.45 g/mol. Its IUPAC name is methyl 4-[(1,4-dimethylpiperazin-2-ylidene)amino]-3-(phenylcarbamoyl)benzoate.
Molecular Properties
| Compound Name | methyl 4-[(1,4-dimethylpiperazin-2-ylidene)amino]-3-(phenylcarbamoyl)benzoate |
| PubChem CID | 71627328 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | methyl 4-[(1,4-dimethylpiperazin-2-ylidene)amino]-3-(phenylcarbamoyl)benzoate |
| SMILES | COC(=O)c1ccc(/N=C2/CN(C)CCN2C)c(C(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C21H24N4O3/c1-24-11-12-25(2)19(14-24)23-18-10-9-15(21(27)28-3)13-17(18)20(26)22-16-7-5-4-6-8-16/h4-10,13H,11-12,14H2,1-3H3,(H,22,26)/b23-19- |
| InChIKey | UTPWYBBWALNFIF-NMWGTECJSA-N |
| XLogP | 2.63 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[(1,4-dimethylpiperazin-2-ylidene)amino]-3-(phenylcarbamoyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(1,4-dimethylpiperazin-2-ylidene)amino]-3-(phenylcarbamoyl)benzoate?
The IUPAC name of methyl 4-[(1,4-dimethylpiperazin-2-ylidene)amino]-3-(phenylcarbamoyl)benzoate (CID 71627328) is methyl 4-[(1,4-dimethylpiperazin-2-ylidene)amino]-3-(phenylcarbamoyl)benzoate.
What is the SMILES notation for methyl 4-[(1,4-dimethylpiperazin-2-ylidene)amino]-3-(phenylcarbamoyl)benzoate?
The canonical SMILES for methyl 4-[(1,4-dimethylpiperazin-2-ylidene)amino]-3-(phenylcarbamoyl)benzoate is COC(=O)c1ccc(/N=C2/CN(C)CCN2C)c(C(=O)Nc2ccccc2)c1.
What is the InChIKey of methyl 4-[(1,4-dimethylpiperazin-2-ylidene)amino]-3-(phenylcarbamoyl)benzoate?
The InChIKey is UTPWYBBWALNFIF-NMWGTECJSA-N. The full InChI is InChI=1S/C21H24N4O3/c1-24-11-12-25(2)19(14-24)23-18-10-9-15(21(27)28-3)13-17(18)20(26)22-16-7-5-4-6-8-16/h4-10,13H,11-12,14H2,1-3H3,(H,22,26)/b23-19-.
What are the key properties of methyl 4-[(1,4-dimethylpiperazin-2-ylidene)amino]-3-(phenylcarbamoyl)benzoate?
methyl 4-[(1,4-dimethylpiperazin-2-ylidene)amino]-3-(phenylcarbamoyl)benzoate has a molecular weight of 380.45 g/mol, XLogP of 2.63, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(1,4-dimethylpiperazin-2-ylidene)amino]-3-(phenylcarbamoyl)benzoate is sourced from PubChem (CID 71627328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).