About 2-(ethylaminomethyl)-6,7-dimethoxy-4aH-quinazolin-4-one;hydrochloride
2-(ethylaminomethyl)-6,7-dimethoxy-4aH-quinazolin-4-one;hydrochloride (PubChem CID 71628081) has the molecular formula C13H18ClN3O3
and a molecular weight of 299.76 g/mol. Its IUPAC name is 2-(ethylaminomethyl)-6,7-dimethoxy-4aH-quinazolin-4-one;hydrochloride.
Molecular Properties
| Compound Name | 2-(ethylaminomethyl)-6,7-dimethoxy-4aH-quinazolin-4-one;hydrochloride |
| PubChem CID | 71628081 |
| Molecular Formula | C13H18ClN3O3 |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 2-(ethylaminomethyl)-6,7-dimethoxy-4aH-quinazolin-4-one;hydrochloride |
| SMILES | CCNCC1=NC(=O)C2C=C(OC)C(OC)=CC2=N1.Cl |
| InChI | InChI=1S/C13H17N3O3.ClH/c1-4-14-7-12-15-9-6-11(19-3)10(18-2)5-8(9)13(17)16-12;/h5-6,8,14H,4,7H2,1-3H3;1H |
| InChIKey | VPTYDJRSCAIOEL-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(ethylaminomethyl)-6,7-dimethoxy-4aH-quinazolin-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethylaminomethyl)-6,7-dimethoxy-4aH-quinazolin-4-one;hydrochloride?
The IUPAC name of 2-(ethylaminomethyl)-6,7-dimethoxy-4aH-quinazolin-4-one;hydrochloride (CID 71628081) is 2-(ethylaminomethyl)-6,7-dimethoxy-4aH-quinazolin-4-one;hydrochloride.
What is the SMILES notation for 2-(ethylaminomethyl)-6,7-dimethoxy-4aH-quinazolin-4-one;hydrochloride?
The canonical SMILES for 2-(ethylaminomethyl)-6,7-dimethoxy-4aH-quinazolin-4-one;hydrochloride is CCNCC1=NC(=O)C2C=C(OC)C(OC)=CC2=N1.Cl.
What is the InChIKey of 2-(ethylaminomethyl)-6,7-dimethoxy-4aH-quinazolin-4-one;hydrochloride?
The InChIKey is VPTYDJRSCAIOEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O3.ClH/c1-4-14-7-12-15-9-6-11(19-3)10(18-2)5-8(9)13(17)16-12;/h5-6,8,14H,4,7H2,1-3H3;1H.
What are the key properties of 2-(ethylaminomethyl)-6,7-dimethoxy-4aH-quinazolin-4-one;hydrochloride?
2-(ethylaminomethyl)-6,7-dimethoxy-4aH-quinazolin-4-one;hydrochloride has a molecular weight of 299.76 g/mol, XLogP of 1.09, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylaminomethyl)-6,7-dimethoxy-4aH-quinazolin-4-one;hydrochloride is sourced from PubChem (CID 71628081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).