C14H22N4O2 — CID 71629492
tert-butyl (3R)-3-(pyrazin-2-ylmethylamino)pyrrolidine-1-carboxylate (PubChem CID 71629492) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is tert-butyl (3R)-3-(pyrazin-2-ylmethylamino)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-(pyrazin-2-ylmethylamino)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71629492 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | tert-butyl (3R)-3-(pyrazin-2-ylmethylamino)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](NCc2cnccn2)C1 |
| InChI | InChI=1S/C14H22N4O2/c1-14(2,3)20-13(19)18-7-4-11(10-18)17-9-12-8-15-5-6-16-12/h5-6,8,11,17H,4,7,9-10H2,1-3H3/t11-/m1/s1 |
| InChIKey | KAWZMHIIIKZJTR-LLVKDONJSA-N |
| XLogP | 1.58 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |